| Primary information |
|---|
| ID | 20045 |
| Pubchem ID | 667476 |
| Name | Dienestrol |
| Description | A synthetic; non-steroidal estrogen structurally related to stilbestrol. It is used; usually as the cream; in the treatment of menopausal and postmenopausal symptoms. |
| Synonym | Dienestrol Dehydrostilbestrol Dienoestrol bp alpha-Dienestrol Dienoestrolum Mesohexestrol Cycladiene Dienoestrol Dienestrol Estraguard Estrodienol |
| Molecular Weight | 266.33 |
| Formula | C18H18O2 |
| IUPAC | 4-[(2E;4E)-4-(4-hydroxyphenyl)hexa-2;4-dien-3-yl]phenol |
| SMILE | CC=C(C1=CC=C(C=C1)O)C(=CC)C2=CC=C(C=C2)O |
| PDB ID | NA |
| KEGG | C08090; D00898 |
| HMDB ID | NA |
| Melting Point (Degree C) | 227.5 |
| Water Solubility | 3mg/ml at 37C |
| Drugbank ID | DB00890 |
| Receptor | P03372 |
| Reference | Pubchem
|