| Primary information |
|---|
| ID | 20043 |
| Pubchem ID | 16752 |
| Name | Dexamethasone Isonicotinate |
| Description | An anti-inflammatory; anti-allergic glucocorticoid that can be administered orally; by inhalation; locally; and parenterally. It may cause water and salt retention. |
| Synonym | Auxiloson Auxilson Auxilsone Voren Auxison Dexamethasone 21-isonicotinate Dexamethasone Isonicotinate |
| Molecular Weight | 497.56 |
| Formula | C28H32FNO6 |
| IUPAC | [2-[(8S;9R;10S;11S;13S;14S;16R;17R)-9-fluoro-11;17-dihydroxy-10;13;16-trimethyl-3-oxo-6;7;8;11;12;14;15;16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]pyridine-4-carboxylate |
| SMILE | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COC(=O)C5=CC=NC=C5)O)C)O)F)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem
|