| Primary information |
|---|
| ID | 20038 |
| Pubchem ID | 40973 |
| Name | Desogestrel |
| Description | A synthetic progestational hormone used often as the progestogenic component of combined oral contraceptive agents. |
| Synonym | Desogestrel Cerazette Marvelon Cyclessa Mircette Kariva ortho-Cept Mixture Name Desogestrelum |
| Molecular Weight | 310.47 |
| Formula | C22H30O |
| IUPAC | (8S;9S;10R;13S;14S;17R)-13-ethyl-17-ethynyl-11-methylidene-1;2;3;6;7;8;9;10;12;14;15;16-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILE | CCC12CC(=C)C3C(C1CCC2(C#C)O)CCC4=CCCCC34 |
| PDB ID | NA |
| KEGG | C07629; D02367 |
| HMDB ID | NA |
| Melting Point (Degree C) | 109.5 |
| Water Solubility | NA |
| Drugbank ID | DB00304 |
| Receptor | P03372; P06401; Q9H2M1; Q9H2M2; Q6TZ07; Q6TZ08; Q8NG42; Q8NG44; Q8NG45; Q8TDS3 |
| Reference | Pubchem
|