| Primary information |
|---|
| ID | 20033 |
| Pubchem ID | 222786 |
| Name | Cortisone |
| Description | A naturally occurring glucocorticoid. It has been used in replacement therapy for adrenal insufficiency and as an anti-inflammatory agent. Cortisone itself is inactive. It is converted in the liver to the active metabolite HYDROCORTISONE. (From Martindale; The Extra Pharmacopoeia; 30th ed; p726) |
| Synonym | Adrenalex Cortisate Cortistal Cortivite Andreson Cortisal Cortogen Cortone Adreson Cortisone |
| Molecular Weight | 360.44 |
| Formula | C21H28O5 |
| IUPAC | (8S;9S;10R;13S;14S;17R)-17-hydroxy-17-(2-hydroxyacetyl)-10;13-dimethyl-1;2;6;7;8;9;12;14;15;16-decahydrocyclopenta[a]phenanthrene-3;11-dione |
| SMILE | CC12CCC(=O)C=C1CCC3C2C(=O)CC4(C3CCC4(C(=O)CO)O)C |
| PDB ID | 3EB3 |
| KEGG | C00762; D07749 |
| HMDB ID | HMDB0002802 |
| Melting Point (Degree C) | 222 |
| Water Solubility | 280mg/ml at 25C |
| Drugbank ID | NA |
| Receptor | P79686; Q6XLJ0; P49115; P04150; P06537; P49843; O73673; Q9N1U3; Q5R9P5; P59667; P06536; P79269; O13186; O46567; P35547; Q95267; P49844; Q3MSN1; Q3MSN4 |
| Reference | Pubchem; HMDB
|