| Primary information |
|---|
| ID | 20032 |
| Pubchem ID | 5753 |
| Name | Corticosterone |
| Description | An adrenocortical steroid that has modest but significant activities as a mineralocorticoid and a glucocorticoid. (From Goodman and Gilman's The Pharmacological Basis of Therapeutics; 8th ed; p1437) |
| Synonym | CORTICOSTERONE Corticosteron 17-Deoxycortisol Compound B Kendall's compound B Reichstein's B Reichstein's substance H cortisone Cortico Compd B |
| Molecular Weight | 346.46 |
| Formula | C21H30O4 |
| IUPAC | (8S;9S;10R;11S;13S;14S;17S)-11-hydroxy-17-(2-hydroxyacetyl)-10;13-dimethyl-1;2;6;7;8;9;11;12;14;15;16;17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILE | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)C)O |
| PDB ID | 1Y5R |
| KEGG | C02140 |
| HMDB ID | HMDB0001547 |
| Melting Point (Degree C) | 181 |
| Water Solubility | 199mg/ml at 25C |
| Drugbank ID | NA |
| Receptor | P79686; Q6XLJ0; P49115; P04150; P06537; P49843; O73673; Q9N1U3; Q5R9P5; P59667; P06536; P79269; O13186; O46567; P35547; Q95267; P49844; Q3MSN1; Q3MSN4 |
| Reference | Pubchem
|