| Primary information |
|---|
| ID | 20031 |
| Pubchem ID | 440707 |
| Name | Cortodoxone |
| Description | 17;21-Dihydroxypregn-4-ene-3;20-dione. A 17-hydroxycorticosteroid with glucocorticoid and anti-inflammatory activities. |
| Synonym | Cortexolone 11-Deoxycortisol Reichstein S Substance S 11 Deoxycortisol 11-Dioxycortisol CORTODOXONE 11-Deoxyhydrocortisone |
| Molecular Weight | 346.46 |
| Formula | C21H30O4 |
| IUPAC | (8R;9S;10R;13S;14S;17R)-17-hydroxy-17-(2-hydroxyacetyl)-10;13-dimethyl-2;6;7;8;9;11;12;14;15;16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILE | CC12CCC(=O)C=C1CCC3C2CCC4(C3CCC4(C(=O)CO)O)C |
| PDB ID | NA |
| KEGG | C05488; D03595 |
| HMDB ID | HMDB0000015 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem; HMDB
|