| Primary information |
|---|
| ID | 20023 |
| Pubchem ID | 65478 |
| Name | betamethasone sodium phosphate |
| Description | phosphate ester of betamethasone; RN given refers to the di-Na salt (11beta;16beta)-isomer; structure in Negwer;5th ed; 4975 |
| Synonym | Bentelan betamethasone sodium phosphate Betnesol Celestone Linolosal Linosal Celestone Soluspan Celestone Phosphate Betasone (Veterinary) beta-Methasone phosphate |
| Molecular Weight | 516.4 |
| Formula | C22H28FNa2O8P |
| IUPAC | disodium[2-[(8S;9R;10S;11S;13S;14S;16S;17R)-9-fluoro-11;17-dihydroxy-10;13;16-trimethyl-3-oxo-6;7;8;11;12;14;15;16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] phosphate |
| SMILE | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COP(=O)([O-])[O-])O)C)O)F)C.[Na+].[Na+] |
| PDB ID | NA |
| KEGG | D00972 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | DB00443 |
| Receptor | P04150 |
| Reference | Pubchem
|