| Primary information |
|---|
| ID | 20021 |
| Pubchem ID | 9782 |
| Name | Betamethasone |
| Description | A glucocorticoid given orally; parenterally; by local injection; by inhalation; or applied topically in the management of various disorders in which corticosteroids are indicated. Its lack of mineralocorticoid properties makes betamethasone particularly suitable for treating cerebral edema and c |
| Synonym | betamethasone Rinderon Celestone Betadexamethasone Betafluorene Betamamallet Betamethazone Flubenisolone Betacorlan Betacortril |
| Molecular Weight | 392.46 |
| Formula | C22H29FO5 |
| IUPAC | (8S;9R;10S;11S;13S;14S;16S;17R)-9-fluoro-11;17-dihydroxy-17-(2-hydroxyacetyl)-10;13;16-trimethyl-6;7;8;11;12;14;15;16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILE | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C |
| PDB ID | NA |
| KEGG | D00244 |
| HMDB ID | NA |
| Melting Point (Degree C) | 232 |
| Water Solubility | 66.5mg/ml at 25C |
| Drugbank ID | DB00443 |
| Receptor | P04150 |
| Reference | Pubchem
|