| Primary information |
|---|
| ID | 20019 |
| Pubchem ID | 20469 |
| Name | Beclomethasone |
| Description | An anti-inflammatory; synthetic glucocorticoid. It is used topically as an anti-inflammatory agent and in aerosol form for the treatment of ASTHMA. |
| Synonym | beclomethasone Becotide Beclometason Beclocort |
| Molecular Weight | 408.92 |
| Formula | C22H29ClO5 |
| IUPAC | (8S;9R;10S;11S;13S;14S;16S;17R)-9-chloro-11;17-dihydroxy-17-(2-hydroxyacetyl)-10;13;16-trimethyl-6;7;8;11;12;14;15;16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILE | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)Cl)C |
| PDB ID | NA |
| KEGG | C06842; D07495 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | DB00394 |
| Receptor | P79686; Q6XLJ0; P49115; P04150; P06537; P49843; O73673; Q9N1U3; Q5R9P5; P59667; P06536; P79269; O13186; O46567; P35547; Q95267; P49844; Q3MSN1; Q3MSN4 |
| Reference | Pubchem
|