| Primary information |
|---|
| ID | 20017 |
| Pubchem ID | 6128 |
| Name | Androstenedione |
| Description | A delta-4 C19 steroid that is produced not only in the TESTIS; but also in the OVARY and the ADRENAL CORTEX. Depending on the tissue type; androstenedione can serve as a precursor to TESTOSTERONE as well as ESTRONE and ESTRADIOL. |
| Synonym | androstenedione Androtex Andro 4-Androstenedione 4-Androstene-3;17-dione Androst-4-ene-3;17-dione Fecundin delta-4-Androstenedione 17-Ketotestosterone 3;17-Dioxoandrost-4-ene |
| Molecular Weight | 286.41 |
| Formula | C19H26O2 |
| IUPAC | (8R;9S;10R;13S;14S)-10;13-dimethyl-2;6;7;8;9;11;12;14;15;16-decahydro-1H-cyclopenta[a]phenanthrene-3;17-dione |
| SMILE | CC12CCC(=O)C=C1CCC3C2CCC4(C3CCC4=O)C |
| PDB ID | 1QYX |
| KEGG | C00280; D00051 |
| HMDB ID | HMDB0000053 |
| Melting Point (Degree C) | 158 |
| Water Solubility | 57.8mg/ml at 25C |
| Drugbank ID | DB01536 |
| Receptor | Q9TT90; Q8MIK0; O97776; P10275; O97952; Q6QT55; P19091; O97775; O97960; Q9GKL7; P49699; Q7T1K4; P15207; O18925; O18928; O55065; O55066; O93244; O93245 |
| Reference | Pubchem; HMDB
|