| Primary information |
|---|
| ID | 20016 |
| Pubchem ID | 10634 |
| Name | Androstenediol |
| Description | An intermediate in TESTOSTERONE biosynthesis; found in the TESTIS or the ADRENAL GLANDS. Androstenediol; derived from DEHYDROEPIANDROSTERONE by the reduction of the 17-keto group (17-HYDROXYSTEROID DEHYDROGENASES); is converted to TESTOSTERONE by the oxidation of the 3-beta hydroxyl group to a 3 |
| Synonym | Androstenediol Hermaphrodiol Androst-5-enediol Tetrabol Neumune Tetrabol (TN) Delta 5-Androstenediol Androst-5-ene-3beta;17beta-diol |
| Molecular Weight | 290.44 |
| Formula | C19H30O2 |
| IUPAC | (3S;8R;9S;10R;13S;14S;17S)-10;13-dimethyl-2;3;4;7;8;9;11;12;14;15;16;17-dodecahydro-1H-cyclopenta[a]phenanthrene-3;17-diol |
| SMILE | CC12CCC3C(C1CCC2O)CC=C4C3(CCC(C4)O)C |
| PDB ID | NA |
| KEGG | C04295; D00179 |
| HMDB ID | HMDB0003818 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q9TT90; Q8MIK0; O97776; P10275; O97952; Q6QT55; P19091; O97775; O97960; Q9GKL7; P49699; Q7T1K4; P15207; O18925; O18928; O55065; O55066; O93244; O93245 |
| Reference | Pubchem; HMDB
|