Primary information |
---|
ID | 20016 |
Pubchem ID | 10634 |
Name | Androstenediol |
Description | An intermediate in TESTOSTERONE biosynthesis; found in the TESTIS or the ADRENAL GLANDS. Androstenediol; derived from DEHYDROEPIANDROSTERONE by the reduction of the 17-keto group (17-HYDROXYSTEROID DEHYDROGENASES); is converted to TESTOSTERONE by the oxidation of the 3-beta hydroxyl group to a 3 |
Synonym | Androstenediol Hermaphrodiol Androst-5-enediol Tetrabol Neumune Tetrabol (TN) Delta 5-Androstenediol Androst-5-ene-3beta;17beta-diol |
Molecular Weight | 290.44 |
Formula | C19H30O2 |
IUPAC | (3S;8R;9S;10R;13S;14S;17S)-10;13-dimethyl-2;3;4;7;8;9;11;12;14;15;16;17-dodecahydro-1H-cyclopenta[a]phenanthrene-3;17-diol |
SMILE | CC12CCC3C(C1CCC2O)CC=C4C3(CCC(C4)O)C |
PDB ID | NA |
KEGG | C04295; D00179 |
HMDB ID | HMDB0003818 |
Melting Point (Degree C) | NA |
Water Solubility | NA |
Drugbank ID | NA |
Receptor | Q9TT90; Q8MIK0; O97776; P10275; O97952; Q6QT55; P19091; O97775; O97960; Q9GKL7; P49699; Q7T1K4; P15207; O18925; O18928; O55065; O55066; O93244; O93245 |
Reference | Pubchem; HMDB
|