| Primary information |
|---|
| ID | 20012 |
| Pubchem ID | 32327 |
| Name | Algestone Acetophenide |
| Description | A progesterone that has been used in ESTRUS SYNCHRONIZATION and has been evaluated as an injectable contraceptive in combination with estradiol enanthate. It is also used therapeutically as a topical anti-inflammatory and is applied topically in the treatment of ACNE. |
| Synonym | Deladroxone Bovitrol Neolutin Droxone Algeston acetofenid P-Dhp Alphasone acetophenide |
| Molecular Weight | 448.59 |
| Formula | C29H36O4 |
| IUPAC | NA |
| SMILE | CC(=O)C12C(CC3C1(CCC4C3CCC5=CC(=O)CCC45C)C)OC(O2)(C)C6=CC=CC=C6 |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | NA |
| Melting Point (Degree C) | 150.5 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem
|