| Primary information |
|---|
| ID | 20010 |
| Pubchem ID | 5839 |
| Name | Aldosterone |
| Description | A hormone secreted by the ADRENAL CORTEX that regulates electrolyte and water balance by increasing the renal retention of sodium and the excretion of potassium. |
| Synonym | ALDOSTERONE Electrocortin Aldocortin Elektrocortin Aldocorten Aldocortene d-Aldosterone Reichstein X (+)-Aldosterone 18-Oxocorticosterone |
| Molecular Weight | 360.44 |
| Formula | C21H28O5 |
| IUPAC | (8S;9S;10R;11S;13R;14S;17S)-11-hydroxy-17-(2-hydroxyacetyl)-10-methyl-3-oxo-1;2;6;7;8;9;11;12;14;15;16;17-dodecahydrocyclopenta[a]phenanthrene-13-carbaldehyde |
| SMILE | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)C=O)O |
| PDB ID | NA |
| KEGG | C01780 |
| HMDB ID | HMDB0000037 |
| Melting Point (Degree C) | 166.5 |
| Water Solubility | 51.2mg/ml at 37C |
| Drugbank ID | DB04630 |
| Receptor | P08235 |
| Reference | Pubchem; HMDB
|