| Primary information |
|---|
| ID | 20004 |
| Pubchem ID | 6238 |
| Name | 17-alpha-Hydroxyprogesterone |
| Description | A metabolite of PROGESTERONE with a hydroxyl group at the 17-alpha position. It serves as an intermediate in the biosynthesis of HYDROCORTISONE and GONADAL STEROID HORMONES. |
| Synonym | Prodix Prodox Gestageno gador hydroxyprogesterone Proluton Setaderm Oxiprogesteronum 17-Hydroxyprogesterone 17-alpha-Hydroxyprogesterone Idrossiprogesterone |
| Molecular Weight | 330.46 |
| Formula | C21H30O3 |
| IUPAC | (8R;9S;10R;13S;14S;17R)-17-acetyl-17-hydroxy-10;13-dimethyl-2;6;7;8;9;11;12;14;15;16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILE | CC(=O)C1(CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)O |
| PDB ID | NA |
| KEGG | C01176 |
| HMDB ID | HMDB0000374 |
| Melting Point (Degree C) | |
| Water Solubility | 6.48mg/ml at 27C |
| Drugbank ID | NA |
| Receptor | P06401; Q8NG42; Q8NG43; Q8NG44; Q8TDS3 |
| Reference | Pubchem; HMDB
|