| Primary information |
|---|
| ID | 20001 |
| Pubchem ID | 123917 |
| Name | 2;3-bis(3'-hydroxybenzyl)butyrolactone |
| Description | lignand isolated from urine of humans and other mammals; RN given refers to cpd without isomeric designation; structure given in second source |
| Synonym | Enterolactone BHMDF HPMF 2;3-Bhbb trans-2;3-Bis(3-hydroxybenzyl)-gamma-butyrolactone 3;4-Bis((3-hydroxyphenyl)methyl)dihydro-2-(3H)-furanone 2;3-bis(3'-hydroxybenzyl)butyrolactone |
| Molecular Weight | 298.33 |
| Formula | C18H18O4 |
| IUPAC | 3;4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one |
| SMILE | C1C(C(C(=O)O1)CC2=CC(=CC=C2)O)CC3=CC(=CC=C3)O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q9YHT3; P49884; P06212; Q91424; P57717; Q53AD2; Q9TV98; P03372; Q9YHZ7; P49886; Q9QZJ5; P57753; P19785; P16058; P50240; Q9YH33; P50241; O42132; Q29040 |
| Reference | Pubchem
|