A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1030 |
PubChem ID | 71386 |
Hormone name | Clobetasone butyrate |
Description | |
Synonyms | Eumovate Molivate Kindavate Trimovate Emovate Kindavate (TN) Clobetasone 17-butyrate clobetasone butyrate |
Molecular weight | 478.98 |
Molecular formula | C26H32ClFO5 |
IUPAC Name | [(8S,9R,10S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-10,13,16-trimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] butano ate |
Canonical smiles | CCCC(=O)OC1(C(CC2C1(CC(=O)C3(C2CCC4=CC(=O)C=CC43C)F)C)C)C(=O)CCl |
Isomeric smiles | CCCC(=O)O[C@@]1([C@H](C[C@@H]2[C@@]1(CC(=O)[C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)C)C)C(=O)CCl
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | D01273   |
HMDB ID | N/A |
Melting Point | 90-100(EXP) |
Log P | 3.76(EXP) |
Water Solubility | 0.6(EST) at 25C |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | N/A |
Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
References | Pubchem |