A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1030 |
| PubChem ID | 71386 |
| Hormone name | Clobetasone butyrate |
| Description | |
| Synonyms | Eumovate Molivate Kindavate Trimovate Emovate Kindavate (TN) Clobetasone 17-butyrate clobetasone butyrate |
| Molecular weight | 478.98 |
| Molecular formula | C26H32ClFO5 |
| IUPAC Name | [(8S,9R,10S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-10,13,16-trimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] butano ate |
| Canonical smiles | CCCC(=O)OC1(C(CC2C1(CC(=O)C3(C2CCC4=CC(=O)C=CC43C)F)C)C)C(=O)CCl |
| Isomeric smiles | CCCC(=O)O[C@@]1([C@H](C[C@@H]2[C@@]1(CC(=O)[C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)C)C)C(=O)CCl
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D01273 |
| HMDB ID | N/A |
| Melting Point | 90-100(EXP) |
| Log P | 3.76(EXP) |
| Water Solubility | 0.6(EST) at 25C |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |