A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1013 |
| PubChem ID | 235905 |
| Hormone name | Allylestrenol |
| Description | A synthetic steroid with progestational activity. |
| Synonyms | allylestrenol Gestanin Gestanol Gestanon Gestanyn Orageston Organon Turinal Gestormone |
| Molecular weight | 300.48 |
| Molecular formula | C21H32O |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-13-methyl-17-prop-2-enyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| Canonical smiles | CC12CCC3C(C1CCC2(CC=C)O)CCC4=CCCCC34 |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(CC=C)O)CCC4=CCCC[C@H]34
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C12811 D01374 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | DB01431 |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |