A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1366 |
| PubChem ID | 5280360 |
| Hormone name | Prostaglandin E2 |
| Description | The most common and most biologically active of the mammalian prostaglandins. It exhibits most biological activities characteristic of prostaglandins and has been used extensively as an oxytocic agent. The compound also displays a protective effect on the intestinal mucosa. |
| Synonyms | Dinoprostone Dinoprostone Prostaglandin E2 Dinoprostone Dinoproston Prepidil Prostin PGE2 Dinoprostone Prostin E2 Cervidil Glandin l-Prostaglandin E2 |
| Molecular weight | 352.47 |
| Molecular formula | C20H32O5 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| Canonical smiles | CCCCCC(C=CC1C(CC(=O)C1CC=CCCCC(=O)O)O)O |
| Isomeric smiles | CCCCC[C@@H](C=C[C@H]1[C@@H](CC(=O)[C@@H]1CC=C/CCCC(=O)O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C00584 D00079 |
| HMDB ID | HMDB01220 |
| Melting Point | 67(EXP) |
| Log P | 2.82(EXP) |
| Water Solubility | 58.1(EST) |
| DrugBank ID | DB00917 |
| Drugpedia | wiki |
| Receptor | P34995 Detail in HMRbase P43116 Detail in HMRbase P43115 Detail in HMRbase P35408 Detail in HMRbase |
| Comments | |
| References | Endonet |