A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1250 |
| PubChem ID | 643658 |
| Hormone name | Guggulsterone M |
| Description | |
| Synonyms | Guggulsterone M 20-Methoxy-4,17(20)E-pregnadiene-3,16-dione (8xi,9xi,14xi,17E)-20-methoxypregna-4,17-diene-3,16-dione pregna-4,17-diene-3,16-dione, 20-methoxy-, (8xi,9xi,14xi,17E)- 17-(1-Methoxy-ethylidene)-10,13-dimethyl-1,6,7,8,9,10,11,12,13,14, 15,17-dodecahydro-2H-cyclopentaphenanthrene-3,16-dione |
| Molecular weight | 342.47 |
| Molecular formula | C22H30O3 |
| IUPAC Name | (8S,9R,10R,13S,14S,17E)-17-(1-methoxyethylidene)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,16-dione |
| Canonical smiles | CC(=C1C(=O)CC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)OC |
| Isomeric smiles | C/C(=C/1C(=O)C[C@@H]2[C@@]1(CC[C@@H]3[C@@H]2CCC4=CC(=O)CC[C@]34C)C)/OC
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB02726 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q3SZL0 Detail in HMRbase Q96RI1 Detail in HMRbase Q60641 Detail in HMRbase Q62735 Detail in HMRbase Q811W9 Detail in HMRbase Q811X0 Detail in HMRbase Q811X1 Detail in HMRbase Q811X2 Detail in HMRbase Q8JHU2 Detail in HMRbase |
| Comments | !Link to Receptor is not Organism Specific |
| References | HMDB |