A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1083 |
| PubChem ID | 896 |
| Hormone name | Melatonin |
| Description | A biogenic amine that is found in animals and plants. In mammals, melatonin is produced by the PINEAL GLAND. Its secretion increases in darkness and decreases during exposure to light. Melatonin is implicated in the regulation of SLEEP, mood, and REPRODUCTION. Melatonin is also an effective antioxidant. |
| Synonyms | Melatonin Melatonine Circadin N-Acetyl-5-methoxytryptamine Melapure Melovine Posidorm Melatol Regulin 5-Methoxy-N-acetyltryptamine |
| Molecular weight | 232.28 |
| Molecular formula | C13H16N2O2 |
| IUPAC Name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| Canonical smiles | CC(=O)NCCC1=CNC2=C1C=C(C=C2)OC |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 2QWX 2QX4 2QX6 |
| KEGG ID | C01598 |
| HMDB ID | HMDB01389 |
| Melting Point | 117(EXP) |
| Log P | 1.65(EST) |
| Water Solubility | N/A |
| DrugBank ID | DB01065 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase P48039 Detail in HMRbase |
| Comments | |
| References | Pubchem |