A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1015 |
| PubChem ID | 10635 |
| Hormone name | Dihydrotestosterone |
| Description | A potent androgenic metabolite of TESTOSTERONE. Dihydrotestosterone (DHT) is generated by a 5-alpha reduction of testosterone. Unlike testosterone, DHT cannot be aromatized to ESTRADIOL therefore DHT is considered a pure androgenic steroid. |
| Synonyms | Androstanolone Dihydrotestosterone Andractim Anaboleen Androlone Stanaprol Anabolex Proteina Protona STANOLONE |
| Molecular weight | 290.44 |
| Molecular formula | C19H30O2 |
| IUPAC Name | (5S,8R,9S,10S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC12CCC(=O)CC1CCC3C2CCC4(C3CCC4O)C |
| Isomeric smiles | C[C@]12CCC(=O)C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4O)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1D2S 1F5F 1KDK 1KDM 1T73 1T74 1T76 1T79 1T7F 1T7M 1T7R 1T7T 1T5Z 1T63 1T65 1XJ7 2AMA 2PIO 2PIP 2PIQ 2PIR 2PIT 2PIU 2PIV 2PIW 2PIX 2PKL 2QPY 2Z4J |
| KEGG ID | C03917 D07456 |
| HMDB ID | HMDB02961 |
| Melting Point | 181(EXP) |
| Log P | 3.55(EXP) |
| Water Solubility | 5.25E+05(EXP) at 25C |
| DrugBank ID | DB02901 |
| Drugpedia | wiki |
| Receptor | P10275 Detail in HMRbase P15207 Detail in HMRbase |
| Comments | |
| References | Pubchem,HMDB |