Details of SAPdb ID 1977 |
Primary information | ||
---|---|---|
SAPdb_ID | 1977 | |
PMID | 28787634 | |
Year | 2017 | |
Name | N-3β-(4-t-Butylbenzoylamine)-(7α,12α-dihydroxy-5β-cholan-24- oyl)-(S)-arginine-(S)-glycine-(S)-a | |
Sequence | RGD | |
N-Terminal Modification | Free | |
C-Terminal Modification | tbutPhC | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | circular dichroism (CD), UV absorption spectroscopy, cryogenic transmission electron microscopy (cryo-TEM), small angle X-ray scattering (SAXS) and static light scattering (SLS) | |
Solvent | sodium carbonate/bicarbonate buffers | |
Method | NA | |
Concentration | 5.0 x 10-3 M | |
pH | 10 | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | long twisted ribbons | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Unstable | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O |