Welcome to Entry Card of Peptide
Details of SAPdb ID 1944 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1944 | |
| PMID | 28589640 | |
| Year | 2017 | |
| Name | Boc-Val-Leu-OMe | |
| Sequence | VL | |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) | |
| C-Terminal Modification | Methoxy | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | SEM, circular dichroism, attenuated total internal reflection-fourier transform infrared spectroscopy, X-ray diffraction and microscopy | |
| Solvent | organic solvents | |
| Method | NA | |
| Concentration | 6 mM | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | 30 min | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanotubes | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O | |