Details of SAPdb ID 1844 |
Primary information | ||
---|---|---|
SAPdb_ID | 1844 | |
PMID | 27508285 | |
Year | 2016 | |
Name | Boc-L-Phe-L-Ala-OMe | |
Sequence | FA | |
N-Terminal Modification | Boc (or t-butoxycarbonyl) | |
C-Terminal Modification | Methoxy | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | NA | |
Method | NA | |
Concentration | NA | |
pH | NA | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | No | |
Type of Self-Assembly | NA | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | NA | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C)C(=O)O |