Welcome to Entry Card of Peptide
Details of SAPdb ID 1839 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1839 | |
| PMID | 27507432 | |
| Year | 2016 | |
| Name | LeuΔPhe (Leucine-α, β-dehydroPhenylalanine) | |
| Sequence | L-Delta-F | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | Delta-F or Δphe=alpha-beta-dehydrophenylalanine | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | α,β-dehydrophenylalanine (ΔPhe) | |
| Technique | TEM, SEM, ESEM,CD and FTIR spectroscopy. | |
| Solvent | sodium acetate buffer | |
| Method | solution phase peptide synthesis | |
| Concentration | 0.8 M | |
| pH | 7 | |
| Temperature | 37 °C | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Hydrogels | |
| Size of Self-Assembled structure | ~2 μm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |