Details of SAPdb ID 1791 |
Primary information | ||
---|---|---|
SAPdb_ID | 1791 | |
PMID | 30356964 | |
Year | 2018 | |
Name | PDA-CD-RGD | |
Sequence | RGD | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | conjugated | |
Conjugate Partner | PDA-CD | |
Technique | TEM, UV/vis spectra, FT-IR | |
Solvent | NA | |
Method | NA | |
Concentration | NA | |
pH | NA | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanoparticles | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Stable | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O |