Welcome to Entry Card of Peptide
Details of SAPdb ID 1724 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1724 | |
| PMID | 30413890 | |
| Year | 2018 | |
| Name | arginine-glycine-aspartic acid | |
| Sequence | RGD | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | None | |
| Technique | NA | |
| Solvent | conductor-like polarizable continuum model (CPCM) | |
| Method | Studying the chemical reactivity properties of the target tumor-environment tripeptides NGR (asparagine-glycine-arginine) and RGD (arginine-glycine-aspartic acid) in their interactions with tamoxifen through conceptual density functional theory | |
| Concentration | NA | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | No | |
| Type of Self-Assembly | nanodiamonds | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |