Welcome to Entry Card of Peptide
Details of SAPdb ID 1703 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1703 | |
| PMID | 30175529 | |
| Year | 2019 | |
| Name | glutaraldehyde | |
| Sequence | GA | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | peptide | |
| Conjugate Partner | None | |
| Technique | (FTIR) and (ESI MS) | |
| Solvent | 1,1,1,3,3,3-hexafluoro-2-propanol (HFP) | |
| Method | In the process of peptide (CDP, H-pHe-pHe-NH2∙HCl) self- assembly, glutaraldehyde (GA) was used as a cross-linker and the resulting product due to the Schiff base reaction can be fluorescent. | |
| Concentration | 4 mL of 25% (w/v) | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanoparticles | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@]([H])(C)C(=O)O | |