Welcome to Entry Card of Peptide
Details of SAPdb ID 1667 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1667 | |
| PMID | 29776313 | |
| Year | 2018 | |
| Name | arginine-glycine-aspartic acid | |
| Sequence | RGD | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | conjugate | |
| Conjugate Partner | Gly-Arg-Gly-Asp-Ser-Pro-Lys (GRGDSPK) | |
| Technique | Fourier transform infrared (FTIR) spectroscopy | |
| Solvent | EDC simultaneously with NHS | |
| Method | NA | |
| Concentration | 0.5 mg mL−1 | |
| pH | 8 | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | NA | |
| Type of Self-Assembly | nanoscaled coating | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |