Welcome to Entry Card of Peptide
Details of SAPdb ID 1651 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1651 | |
| PMID | 29384183 | |
| Year | 2018 | |
| Name | perylene bisimide (PBI) | |
| Sequence | GY | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | conjugate | |
| Conjugate Partner | PBI-[GY]2 | |
| Technique | Transmission Electron Microscopy (TEM) | |
| Solvent | PBS buffer solution | |
| Method | NA | |
| Concentration | 0.019 mM | |
| pH | NA | |
| Temperature | 27.7°C | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanofibers and nanospHeres | |
| Size of Self-Assembled structure | 20nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O | |