Details of SAPdb ID 1647 |
Primary information | ||
---|---|---|
SAPdb_ID | 1647 | |
PMID | 29368775 | |
Year | 2018 | |
Name | arginine-glycine-aspartic acid | |
Sequence | RGD | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | tripeptide | |
Conjugate Partner | None | |
Technique | NMR | |
Solvent | chloroform (CDCl3) or deuterium oxide (D2O) | |
Method | NA | |
Concentration | 1 g/L. | |
pH | 5.5 | |
Temperature | (-20°C) | |
Incubation Period | NA | |
Self-Assembly Formation | No | |
Type of Self-Assembly | NA | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O |