Details of SAPdb ID 1418 |
Primary information | ||
---|---|---|
SAPdb_ID | 1418 | |
PMID | 26086903 | |
Year | 2015 | |
Name | Val-Ala | |
Sequence | VA | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Scanning Electron Microscopy (SEM) | |
Solvent | Pyrimidine | |
Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. | |
Concentration | 2mg/ml | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Square plate-like structures | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O |