Details of SAPdb ID 1262 |
Primary information | ||
---|---|---|
SAPdb_ID | 1262 | |
PMID | 19852501 | |
Year | 2009 | |
Name | B or AcK(NDI)K-NH2 | |
Sequence | KK | |
N-Terminal Modification | Acetylation | |
C-Terminal Modification | Amidation | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Conjugate | |
Conjugate Partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide | |
Technique | Transmission Electron Microscopy (TEM), AFM (Atomic Force Microscopy) | |
Solvent | Water | |
Method | Peptide dissolved in water. 10 ul of peptide solution at conc 250 μM incubated atleast for 2 hours at mica surface. | |
Concentration | 250 μM | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | > 2 hours | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Flattened, twisted Nanoribbons | |
Size of Self-Assembled structure | Width 20-70 nm and height 16nm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | CC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N |