Details of SAPdb ID 1129 |
Primary information | ||
---|---|---|
SAPdb_ID | 1129 | |
PMID | 25010703 | |
Year | 2014 | |
Name | Ac-LLE | |
Sequence | LLE | |
N-Terminal Modification | Acetylation | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | FE - SEM (Field Emission Scanning Electron Microscopy) | |
Solvent | water | |
Method | The peptides were dissolved by vortexing in deionized water. For proper self-asSEM (Scanning Electron Microscopy)bly, all The tripeptide sampleskept for 24 hours | |
Concentration | 5-40mg/ml | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | 48hours and 10 minutes | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Bead like Nanostructure | |
Size of Self-Assembled structure | Diameter: 4-10um | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C=O |