Details of SAPdb ID 1017 |
Primary information | ||
---|---|---|
SAPdb_ID | 1017 | |
PMID | 17172307 | |
Year | 2007 | |
Name | NH2-Ile-Phe-COOH | |
Sequence | IF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Transmission Electron Microscopy (TEM), Scanning Electron Microscopy (SEM) | |
Solvent | Aqueous dispersion | |
Method | Dipeptide samples were diluted in 1,1,1,3,3,3 hexafluoro-2-propanol to obtain stocks of 100 mg/ml and 200 mg/ml, which were further diluted in water | |
Concentration | 2% (w/v) | |
pH | 5.8 | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanofibrils | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](Cc1ccccc1)C=O |