| Primary information |
|---|
| PRRID | PRRID_0188 |
| Ligand Name | Tri-DAP (L-Ala-D-g-Glu-mDAP) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)NC(CCCC(C(=O)O)N)C(=O)O)C(=O)O)N |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | activation of the NF-κB pro-inflammatory cascade |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | Phagocytosis of pathogens, Antigen presentation, Intracellular signalling, Resolution of inflammation |
| Assay used | NA |
| PMID | 12527755 |
| Year of Publication | 2003 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0188 |
| Ligand Name | Tri-DAP (L-Ala-D-g-Glu-mDAP) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)NC(CCCC(C(=O)O)N)C(=O)O)C(=O)O)N |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | activation of the NF-κB pro-inflammatory cascade |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | Phagocytosis of pathogens, Antigen presentation, Intracellular signalling, Resolution of inflammation |
| Assay used | NA |
| PMID | 12527755 |
| Year of Publication | 2003 |
| Pubchem assay | Pubchem Assay |