ParaPep -A Database of Anti-parasitic peptides
Detailed description page of ParaPep |
| This page displays user query in tabular form. |
1562 details |
| Primary information | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| ParaPep ID | 1562 | ||||||||||||||||
| PMID | 14638488 | ||||||||||||||||
| YEAR | 2003 | ||||||||||||||||
| SEQUENCE | F-hPhe | ||||||||||||||||
| LENGTH | 2 | ||||||||||||||||
| NAME | Compound 9038 | ||||||||||||||||
| C-ter Modification | Al=aldehyde | ||||||||||||||||
| N-ter Modification | Z=benzyloxycarbonyl | ||||||||||||||||
| Linear/Cyclic | Linear | ||||||||||||||||
| Stereochemistry | L | ||||||||||||||||
| Chemical Modification | HPhe- homophenylalanine | ||||||||||||||||
| Disease | Malaria | ||||||||||||||||
| Assay | Flourimetry (Hydrolysis of the fluorogenic substrate) | ||||||||||||||||
| Parasite Type | Plasmodium falciparum W2 | ||||||||||||||||
| In-vivo/vitro | In vitro | ||||||||||||||||
| Activity | IC50 for falcipain-2=20nM | ||||||||||||||||
| Hemolysis | Not reported | ||||||||||||||||
| Nature | Cysteine protease inhibitor | ||||||||||||||||
| Secondary information | |||||||||||||||||
| STRUCTURE |
| ||||||||||||||||
| DSSP states | NA | ||||||||||||||||
| SMILES | C1(CCCCC1)CO[C@@H](N[C@@H](CC1CCCCC1)[C@H](N[C@@H](CCC1CCCCC1)[C@H](O)O)O)O | ||||||||||||||||
| External Links | |||||||||||||||||
| |||||||||||||||||