ParaPep -A Database of Anti-parasitic peptides Detailed description page of ParaPep |
| This page displays user query in tabular form. |
1252 details |
| Primary information | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| ParaPep ID | 1252 | ||||||||||||||||
| PMID | 1693777 | ||||||||||||||||
| YEAR | 1990 | ||||||||||||||||
| SEQUENCE | kwklfkkigigavlkvlttglpalis | ||||||||||||||||
| LENGTH | 26 | ||||||||||||||||
| NAME | D-[CA-(1-8)-M-(1-18)NH2] | ||||||||||||||||
| C-ter Modification | Amidation | ||||||||||||||||
| N-ter Modification | Free | ||||||||||||||||
| Linear/Cyclic | Linear | ||||||||||||||||
| Stereochemistry | D | ||||||||||||||||
| Chemical Modification | None | ||||||||||||||||
| Disease | Malaria | ||||||||||||||||
| Assay | Microscopy (Acridine orange staining) | ||||||||||||||||
| Parasite Type | Plasmodium falciparum F32 Tanzania | ||||||||||||||||
| In-vivo/vitro | In vitro | ||||||||||||||||
| Activity | Caused a 50% inhibition of the reinvasion of eryth | ||||||||||||||||
| Hemolysis | HC50 >400μM | ||||||||||||||||
| Nature | Antimicrobial, antibiotic | ||||||||||||||||
| Secondary information | |||||||||||||||||
| STRUCTURE |
| ||||||||||||||||
| DSSP states | CCSTTCCTTTTTTGGGGGCCSCCCCC | ||||||||||||||||
| SMILES | N[C@H](CCCCN)C(=O)N[C@H](Cc1c[nH]c(C)c1CC)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCCCN)C(=O)N[C@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H]([C@@H](C)O)C(=O)N[C@H]([C@@H](C)O)C(=O)NCC(=O)N[C@H](CC(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@H](CO)C(=O)N | ||||||||||||||||
| External Links | |||||||||||||||||
| |||||||||||||||||