ParaPep -A Database of Anti-parasitic peptides
Detailed description page of ParaPep |
| This page displays user query in tabular form. |
1235 details |
| Primary information | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| ParaPep ID | 1235 | ||||||||||||||||
| PMID | 22869378 | ||||||||||||||||
| YEAR | 2012 | ||||||||||||||||
| SEQUENCE | kkalahalkkwlpalkklahalakk | ||||||||||||||||
| LENGTH | 25 | ||||||||||||||||
| NAME | D-LAK120-HP13 | ||||||||||||||||
| C-ter Modification | Amidation | ||||||||||||||||
| N-ter Modification | Free | ||||||||||||||||
| Linear/Cyclic | Linear | ||||||||||||||||
| Stereochemistry | D | ||||||||||||||||
| Chemical Modification | None | ||||||||||||||||
| Disease | Malaria | ||||||||||||||||
| Assay | Fluorimetry (SYBR Green II) | ||||||||||||||||
| Parasite Type | Plasmodium falciparum C10 | ||||||||||||||||
| In-vivo/vitro | In vitro | ||||||||||||||||
| Activity | IC50=2.88 ±0.25 | ||||||||||||||||
| Hemolysis | HC50=79.61±2.80μM | ||||||||||||||||
| Nature | Antimicrobial | ||||||||||||||||
| Secondary information | |||||||||||||||||
| STRUCTURE |
| ||||||||||||||||
| DSSP states | CTTHHHHHHHHCCGGGHHHHHHHTC | ||||||||||||||||
| SMILES | N[C@H](CCCCN)C(=O)N[C@H](CCCCN)C(=O)N[C@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C)C(=O)N[C@H](Cc1[nH]cnc1)C(=O)N[C@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCCCN)C(=O)N[C@H](Cc1c[nH]c(C)c1CC)C(=O)N[C@H](CC(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C)C(=O)N[C@H](Cc1[nH]cnc1)C(=O)N[C@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCCCN)C(=O)N | ||||||||||||||||
| External Links | |||||||||||||||||
| |||||||||||||||||