ParaPep -A Database of Anti-parasitic peptides
Detailed description page of ParaPep |
| This page displays user query in tabular form. |
1086 details |
| Primary information | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| ParaPep ID | 1086 | ||||||||||||||||
| PMID | 11897590 | ||||||||||||||||
| YEAR | 2002 | ||||||||||||||||
| SEQUENCE | ALWKTLLKKVLKA | ||||||||||||||||
| LENGTH | 13 | ||||||||||||||||
| NAME | K4S4(1-13)NH2 (P) | ||||||||||||||||
| C-ter Modification | Amidation | ||||||||||||||||
| N-ter Modification | Free | ||||||||||||||||
| Linear/Cyclic | Linear | ||||||||||||||||
| Stereochemistry | L | ||||||||||||||||
| Chemical Modification | None | ||||||||||||||||
| Disease | Malaria | ||||||||||||||||
| Assay | [3H] Hypoxanthine incorporation assay | ||||||||||||||||
| Parasite Type | Plasmodium falciparum W2 (trophozoite stage) | ||||||||||||||||
| In-vivo/vitro | In vitro | ||||||||||||||||
| Activity | IC50=3.35±0.25μM | ||||||||||||||||
| Hemolysis | <10%hemolysis at 10 uM | ||||||||||||||||
| Nature | Antimicrobial | ||||||||||||||||
| Secondary information | |||||||||||||||||
| STRUCTURE |
| ||||||||||||||||
| DSSP states | CTHHHHHHHHSCC | ||||||||||||||||
| SMILES | N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]c(C)c1CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N | ||||||||||||||||
| External Links | |||||||||||||||||
| |||||||||||||||||