A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1112 |
PubChem ID | 25249 |
Hormone name | Stanozolol |
Description | A synthetic steroid that has anabolic and androgenic properties. (From Martindale, The Extra Pharmacopoeia, 30th ed, p1194) |
Synonyms | Stanozolol Androstanazole Winstrol Stromba Androstanazol Strombaject Tevabolin Winstroid Estazol |
Molecular weight | 328.49 |
Molecular formula | C21H32N2O |
IUPAC Name | N/A |
Canonical smiles | CC12CCC3C(C1CCC2(C)O)CCC4C3(CC5=C(C4)NN=C5)C |
Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CC[C@@H]4[C@@]3(CC5=C(C4)NN=C5)C
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | C07311 D00444   |
HMDB ID | N/A |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | P15207 Detail in HMRbase |
Comments | |
References | Pubchem |