A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1104 |
PubChem ID | 5865 |
Hormone name | Prednisone |
Description | A synthetic anti-inflammatory glucocorticoid derived from CORTISONE. It is biologically inert and converted to PREDNISOLONE in the liver. |
Synonyms | Prednisone Dehydrocortisone Deltacortisone Decortancyl Deltacortone Hostacortin Prednilonga Supercortil Ultracorten Ultracortene |
Molecular weight | 358.43 |
Molecular formula | C21H26O5 |
IUPAC Name | (8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione |
Canonical smiles | CC12CC(=O)C3C(C1CCC2(C(=O)CO)O)CCC4=CC(=O)C=CC34C |
Isomeric smiles | C[C@]12CC(=O)[C@H]3[C@H]([C@@H]1CC[C@@]2(C(=O)CO)O)CCC4=CC(=O)C=C[C@]34C
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | C07370 |
HMDB ID | N/A |
Melting Point | 234(EXP) |
Log P | 1.46(EXP) |
Water Solubility | 312(EST) at 25C |
DrugBank ID | DB00635 |
Drugpedia | wiki |
Receptor | P04150 Detail in HMRbase |
Comments | |
References | Pubchem |