A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1094 |
| PubChem ID | 6010 |
| Hormone name | Methyltestosterone |
| Description | A synthetic hormone used for androgen replacement therapy and as an hormonal antineoplastic agent (ANTINEOPLASTIC AGENTS, HORMONAL). |
| Synonyms | Methyltestosterone Mesterone Testred Synandrotabs Testhormone Andrometh Androsten Homandren Malestrone Mastestona |
| Molecular weight | 302.45 |
| Molecular formula | C20H30O2 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC12CCC(=O)C=C1CCC3C2CCC4(C3CCC4(C)O)C |
| Isomeric smiles | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@]4(C)O)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C07198 D00408 |
| HMDB ID | N/A |
| Melting Point | 163.5(EXP) |
| Log P | 3.36(EXP) |
| Water Solubility | 33.9(EXP) at 25C |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q9TT90 Detail in HMRbase Q8MIK0 Detail in HMRbase O97776 Detail in HMRbase P10275 Detail in HMRbase O97952 Detail in HMRbase Q6QT55 Detail in HMRbase P19091 Detail in HMRbase O97775 Detail in HMRbase O97960 Detail in HMRbase Q9GKL7 Detail in HMRbase P49699 Detail in HMRbase Q7T1K4 Detail in HMRbase P15207 Detail in HMRbase |
| Comments | !Link to Receptor is not Organism Specific |
| References | Pubchem |