A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1093 |
PubChem ID | 23680530 |
Hormone name | Methylprednisolone sodium succinate |
Description | A water-soluble ester of METHYLPREDNISOLONE used for cardiac, allergic, and hypoxic emergencies. |
Synonyms | A-Methapred Methylprednisolone Hemisuccinate Solu-Medrol Asmacortone Metypresol Corticel Emmetipi Metypred Prednilem Firmacort Fiale Nirypan solubile |
Molecular weight | 496.53 |
Molecular formula | C26H33NaO8 |
IUPAC Name | sodium4-[2-[(6S,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoe thoxy]-4-oxobutanoate |
Canonical smiles | CC1CC2C3CCC(C3(CC(C2C4(C1=CC(=O)C=C4)C)O)C)(C(=O)COC(=O)CCC(=O)[O-])O.[Na+] |
Isomeric smiles | C[C@H]1C[C@H]2[C@@H]3CC[C@@]([C@]3(C[C@@H]([C@@H]2[C@@]4(C1=CC(=O)C=C4)C)O)C)(C(=O)COC(=O)CCC(=O)[O-])O.[Na+]
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | D00751   |
HMDB ID | N/A |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | DB00959 |
Drugpedia | wiki |
Receptor | P04150 Detail in HMRbase |
Comments | |
References | Pubchem |