A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1091 |
PubChem ID | 6741 |
Hormone name | Methylprednisolone |
Description | A PREDNISOLONE derivative with similar anti-inflammatory action. |
Synonyms | Methylprednisolone Medrol Medrone Metilbetasone Promacortine Dopomedrol Metrisone Medesone Mesopren Metastab |
Molecular weight | 374.47 |
Molecular formula | C22H30O5 |
IUPAC Name | (6S,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
Canonical smiles | CC1CC2C3CCC(C3(CC(C2C4(C1=CC(=O)C=C4)C)O)C)(C(=O)CO)O |
Isomeric smiles | C[C@H]1C[C@H]2[C@@H]3CC[C@@]([C@]3(C[C@@H]([C@@H]2[C@@]4(C1=CC(=O)C=C4)C)O)C)(C(=O)CO)O
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | D00407    |
HMDB ID | N/A |
Melting Point | 232.5(EXP) |
Log P | 1.82(EST) |
Water Solubility | 120(EXP) at 25C |
DrugBank ID | DB00959 |
Drugpedia | wiki |
Receptor | P04150 Detail in HMRbase |
Comments | |
References | Pubchem |