A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1081 |
PubChem ID | 5754 |
Hormone name | Hydrocortisone |
Description | The main glucocorticoid secreted by the ADRENAL CORTEX. Its synthetic counterpart is used, either as an injection or topically, in the treatment of inflammation, allergy, collagen diseases, asthma, adrenocortical deficiency, shock, and some neoplastic conditions. |
Synonyms | Hydrocortisone Cortisol Cortef Acticort Cetacort Hytone Dihydrocostisone Hydrocortisyl Hydrocortone Corticreme |
Molecular weight | 362.46 |
Molecular formula | C21H30O5 |
IUPAC Name | (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
Canonical smiles | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4(C(=O)CO)O)C)O |
Isomeric smiles | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | 2Q1V  2V95  2VDY   |
KEGG ID | C00735 D00088   |
HMDB ID | HMDB00063 |
Melting Point | 220(EXP) |
Log P | 1.61(EXP) |
Water Solubility | 320(EXP) at 25C |
DrugBank ID | DB00741 |
Drugpedia | wiki |
Receptor | P04150 Detail in HMRbase |
Comments | |
References | Pubchem,HMDB |