A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1023 |
PubChem ID | 65478 |
Hormone name | betamethasone sodium phosphate |
Description | phosphate ester of betamethasone; RN given refers to the di-Na salt (11beta,16beta)-isomer; structure in Negwer,5th ed, 4975 |
Synonyms | Bentelan betamethasone sodium phosphate Betnesol Celestone Linolosal Linosal Celestone Soluspan Celestone Phosphate Betasone (Veterinary) beta-Methasone phosphate |
Molecular weight | 516.4 |
Molecular formula | C22H28FNa2O8P |
IUPAC Name | disodium[2-[(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] -2-oxoethyl] phosphate |
Canonical smiles | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COP(=O)([O-])[O-])O)C)O)F)C.[Na+].[Na+] |
Isomeric smiles | C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)COP(=O)([O-])[O-])O)C)O)F)C.[Na+].[Na +] |
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | D00972   |
HMDB ID | N/A |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | DB00443 |
Drugpedia | wiki |
Receptor | P04150 Detail in HMRbase |
Comments | |
References | Pubchem |