Primary information |
---|
Hemolytik ID | 3825 |
PMID | 9889358 |
YEAR | 1998 |
SEQUENCE | KLLLK |
LENGTH | 5 |
NAME | DnsLK5NH2 |
C-ter Modification | Amidation |
N-ter Modification | Dansylation |
Linear/Cyclic | Linear |
Stereochemistry | L |
Modified Residues | None |
FUNCTION | Cytotoxin |
ACTIVITY | LD50 =90μM |
RBCs SOURCE | Human |
Secondary information |
---|
Properties | Physico-Chemical details |
STRUCTURE | |
DSSP states | CCCCC |
SMILES | N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)O |
External Links |
---|
PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
NA |
NA |
NA |
Q9DA16 from 216 TO 220 |
NA |
I3D4T0 from 224 TO 228 |
NA |
NA |
|
Reference Informaiton |
---|
ARTICLE | The amphipathic helix concept: length effects on ideally amphipathic LiKj(i=2j) peptides to acquire optimal hemolytic activity. |
AUTHORS | Castano S,Cornut I,Buttner K,Dasseux JL |
JOURNAL | Biochim Biophys Acta. 1999 Jan 12;1416(1-2):161-75. |