Primary information |
---|
Hemolytik ID | 3799 |
PMID | 9204560 |
YEAR | 1997 |
SEQUENCE | frlkfh |
LENGTH | 6 |
NAME | 66-10 |
C-ter Modification | Free |
N-ter Modification | Free |
Linear/Cyclic | Linear |
Stereochemistry | D |
Modified Residues | None |
FUNCTION | Antimicrobial |
ACTIVITY | 0% hemolysis at 312 to 0μg/ml |
RBCs SOURCE | Bovine |
Secondary information |
---|
Properties | Physico-Chemical details |
STRUCTURE | |
DSSP states | CCSSCC |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1[nH]cnc1)C(=O)O |
External Links |
---|
PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
|
Reference Informaiton |
---|
ARTICLE | Synthetic peptide combinatorial libraries: a method for the identification of bioactive peptides against phytopathogenic fungi. |
AUTHORS | Reed JD,Edwards DL, Gonzalez, C ,Gonzalez C |
JOURNAL | Mol Plant Microbe Interact. 1997 Jul;10(5):537-49. |