| Primary information |
|---|
| Hemolytik ID | 3474 |
| PMID | 11738089 |
| YEAR | 2001 |
| SEQUENCE | GLLKRIKTLL |
| LENGTH | 10 |
| NAME | Anoplin |
| C-ter Modification | Amidation |
| N-ter Modification | Free |
| Linear/Cyclic | Linear |
| Stereochemistry | L |
| Modified Residues | None |
| FUNCTION | Antimicrobial and Mast cell degranulating |
| ACTIVITY | Low hemolytic activity |
| RBCs SOURCE | Human |
| Secondary information |
|---|
| Properties | Physico-Chemical details |
| STRUCTURE | |
| DSSP states | CGGGTGGGTC |
| SMILES | NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)O |
| External Links |
|---|
| PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
| NA |
NA |
P0C005 |
NA |
NA |
NA |
NA |
NA |
|
| Reference Informaiton |
|---|
| ARTICLE | Anoplin, a novel antimicrobial peptide from the venom of the solitary wasp Anoplius samariensis. |
| AUTHORS | Konno K,Hisada M,Fontana R,Lorenzi CC,Naoki H,Itagaki Y,Miwa A,Kawai N,Nakata Y,Yasuhara T,Ruggiero Neto J,de Azevedo WF Jr,Palma MS |
| JOURNAL | Biochim Biophys Acta. 2001 Nov 26;1550(1):70-80. |
