Primary information |
---|
Hemolytik ID | 3474 |
PMID | 11738089 |
YEAR | 2001 |
SEQUENCE | GLLKRIKTLL |
LENGTH | 10 |
NAME | Anoplin |
C-ter Modification | Amidation |
N-ter Modification | Free |
Linear/Cyclic | Linear |
Stereochemistry | L |
Modified Residues | None |
FUNCTION | Antimicrobial and Mast cell degranulating |
ACTIVITY | Low hemolytic activity |
RBCs SOURCE | Human |
Secondary information |
---|
Properties | Physico-Chemical details |
STRUCTURE | |
DSSP states | CGGGTGGGTC |
SMILES | NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)O |
External Links |
---|
PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
NA |
NA |
P0C005 |
NA |
NA |
NA |
NA |
NA |
|
Reference Informaiton |
---|
ARTICLE | Anoplin, a novel antimicrobial peptide from the venom of the solitary wasp Anoplius samariensis. |
AUTHORS | Konno K,Hisada M,Fontana R,Lorenzi CC,Naoki H,Itagaki Y,Miwa A,Kawai N,Nakata Y,Yasuhara T,Ruggiero Neto J,de Azevedo WF Jr,Palma MS |
JOURNAL | Biochim Biophys Acta. 2001 Nov 26;1550(1):70-80. |